C12H20ClF2NO — CID 107321494
N-(5-chloropentyl)-4,4-difluorocyclohexane-1-carboxamide (PubChem CID 107321494) has the molecular formula C12H20ClF2NO and a molecular weight of 267.75 g/mol. Its IUPAC name is N-(5-chloropentyl)-4,4-difluorocyclohexane-1-carboxamide.
| Compound Name | N-(5-chloropentyl)-4,4-difluorocyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 107321494 |
| Molecular Formula | C12H20ClF2NO |
| Molecular Weight | 267.75 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | N-(5-chloropentyl)-4,4-difluorocyclohexane-1-carboxamide |
| SMILES | O=C(NCCCCCCl)C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C12H20ClF2NO/c13-8-2-1-3-9-16-11(17)10-4-6-12(14,15)7-5-10/h10H,1-9H2,(H,16,17) |
| InChIKey | BRKRZIHGLQNVNP-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.75 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|