C13H22N2O4S — CID 107323800
5-[(cyclopropylamino)methyl]-N-(5-hydroxypentyl)furan-2-sulfonamide (PubChem CID 107323800) has the molecular formula C13H22N2O4S and a molecular weight of 302.40 g/mol. Its IUPAC name is 5-[(cyclopropylamino)methyl]-N-(5-hydroxypentyl)furan-2-sulfonamide.
| Compound Name | 5-[(cyclopropylamino)methyl]-N-(5-hydroxypentyl)furan-2-sulfonamide |
|---|---|
| PubChem CID | 107323800 |
| Molecular Formula | C13H22N2O4S |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | 5-[(cyclopropylamino)methyl]-N-(5-hydroxypentyl)furan-2-sulfonamide |
| SMILES | O=S(=O)(NCCCCCO)c1ccc(CNC2CC2)o1 |
| InChI | InChI=1S/C13H22N2O4S/c16-9-3-1-2-8-15-20(17,18)13-7-6-12(19-13)10-14-11-4-5-11/h6-7,11,14-16H,1-5,8-10H2 |
| InChIKey | DXYJWWKOGNIBSV-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 91.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|