C14H16N2OS2 — CID 10732433
4-cyclohexylsulfanylthieno[2,3-c]pyridine-2-carboxamide (PubChem CID 10732433) has the molecular formula C14H16N2OS2 and a molecular weight of 292.43 g/mol. Its IUPAC name is 4-cyclohexylsulfanylthieno[2,3-c]pyridine-2-carboxamide.
| Compound Name | 4-cyclohexylsulfanylthieno[2,3-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 10732433 |
| Molecular Formula | C14H16N2OS2 |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | 4-cyclohexylsulfanylthieno[2,3-c]pyridine-2-carboxamide |
| SMILES | NC(=O)c1cc2c(SC3CCCCC3)cncc2s1 |
| InChI | InChI=1S/C14H16N2OS2/c15-14(17)11-6-10-12(7-16-8-13(10)19-11)18-9-4-2-1-3-5-9/h6-9H,1-5H2,(H2,15,17) |
| InChIKey | PYXYBCUELBQETB-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |