3-amino-1-(2,2-diethoxyethyl)pyrrolidine-3-carboxylic acid

C11H22N2O4 — CID 107324566

IUPAC3-amino-1-(2,2-diethoxyethyl)pyrrolidine-3-carboxylic acid
SMILESCCOC(CN1CCC(N)(C(=O)O)C1)OCC
InChIInChI=1S/C11H22N2O4/c1-3-16-9(17-4-2)7-13-6-5-11(12,8-13)10(14)15/h9H,3-8,12H2,1-2H3,(H,14,15)
InChIKeyHVAWVSYXJVGWPW-UHFFFAOYSA-N
MW246.31 g/mol
LogP-0.13
Rot. Bonds7

About 3-amino-1-(2,2-diethoxyethyl)pyrrolidine-3-carboxylic acid

3-amino-1-(2,2-diethoxyethyl)pyrrolidine-3-carboxylic acid (PubChem CID 107324566) has the molecular formula C11H22N2O4 and a molecular weight of 246.31 g/mol. Its IUPAC name is 3-amino-1-(2,2-diethoxyethyl)pyrrolidine-3-carboxylic acid.

Molecular Properties

Compound Name3-amino-1-(2,2-diethoxyethyl)pyrrolidine-3-carboxylic acid
PubChem CID107324566
Molecular FormulaC11H22N2O4
Molecular Weight246.31 g/mol
Exact Mass246.16
IUPAC Name3-amino-1-(2,2-diethoxyethyl)pyrrolidine-3-carboxylic acid
SMILESCCOC(CN1CCC(N)(C(=O)O)C1)OCC
InChIInChI=1S/C11H22N2O4/c1-3-16-9(17-4-2)7-13-6-5-11(12,8-13)10(14)15/h9H,3-8,12H2,1-2H3,(H,14,15)
InChIKeyHVAWVSYXJVGWPW-UHFFFAOYSA-N
XLogP-0.13
TPSA85.02 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds7
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500246.31
LogP ≤ 5-0.13
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}

Analyze 3-amino-1-(2,2-diethoxyethyl)pyrrolidine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-amino-1-(2,2-diethoxyethyl)pyrrolidine-3-carboxylic acid?
The IUPAC name of 3-amino-1-(2,2-diethoxyethyl)pyrrolidine-3-carboxylic acid (CID 107324566) is 3-amino-1-(2,2-diethoxyethyl)pyrrolidine-3-carboxylic acid.
What is the SMILES notation for 3-amino-1-(2,2-diethoxyethyl)pyrrolidine-3-carboxylic acid?
The canonical SMILES for 3-amino-1-(2,2-diethoxyethyl)pyrrolidine-3-carboxylic acid is CCOC(CN1CCC(N)(C(=O)O)C1)OCC.
What is the InChIKey of 3-amino-1-(2,2-diethoxyethyl)pyrrolidine-3-carboxylic acid?
The InChIKey is HVAWVSYXJVGWPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2O4/c1-3-16-9(17-4-2)7-13-6-5-11(12,8-13)10(14)15/h9H,3-8,12H2,1-2H3,(H,14,15).
What are the key properties of 3-amino-1-(2,2-diethoxyethyl)pyrrolidine-3-carboxylic acid?
3-amino-1-(2,2-diethoxyethyl)pyrrolidine-3-carboxylic acid has a molecular weight of 246.31 g/mol, XLogP of -0.13, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-1-(2,2-diethoxyethyl)pyrrolidine-3-carboxylic acid is sourced from PubChem (CID 107324566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).