C11H22N2O4 — CID 107324566
3-amino-1-(2,2-diethoxyethyl)pyrrolidine-3-carboxylic acid (PubChem CID 107324566) has the molecular formula C11H22N2O4 and a molecular weight of 246.31 g/mol. Its IUPAC name is 3-amino-1-(2,2-diethoxyethyl)pyrrolidine-3-carboxylic acid.
| Compound Name | 3-amino-1-(2,2-diethoxyethyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 107324566 |
| Molecular Formula | C11H22N2O4 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | 3-amino-1-(2,2-diethoxyethyl)pyrrolidine-3-carboxylic acid |
| SMILES | CCOC(CN1CCC(N)(C(=O)O)C1)OCC |
| InChI | InChI=1S/C11H22N2O4/c1-3-16-9(17-4-2)7-13-6-5-11(12,8-13)10(14)15/h9H,3-8,12H2,1-2H3,(H,14,15) |
| InChIKey | HVAWVSYXJVGWPW-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 85.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|