C12H24N2O4 — CID 107324313
3-amino-1-(3,3-diethoxypropyl)pyrrolidine-3-carboxylic acid (PubChem CID 107324313) has the molecular formula C12H24N2O4 and a molecular weight of 260.33 g/mol. Its IUPAC name is 3-amino-1-(3,3-diethoxypropyl)pyrrolidine-3-carboxylic acid.
| Compound Name | 3-amino-1-(3,3-diethoxypropyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 107324313 |
| Molecular Formula | C12H24N2O4 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.17 |
| IUPAC Name | 3-amino-1-(3,3-diethoxypropyl)pyrrolidine-3-carboxylic acid |
| SMILES | CCOC(CCN1CCC(N)(C(=O)O)C1)OCC |
| InChI | InChI=1S/C12H24N2O4/c1-3-17-10(18-4-2)5-7-14-8-6-12(13,9-14)11(15)16/h10H,3-9,13H2,1-2H3,(H,15,16) |
| InChIKey | ARMPDCHJGIIWTN-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 85.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|