About 3-amino-1-(4,4,4-trifluorobutyl)pyrrolidine-3-carboxylic acid
3-amino-1-(4,4,4-trifluorobutyl)pyrrolidine-3-carboxylic acid (PubChem CID 107324867) has the molecular formula C9H15F3N2O2
and a molecular weight of 240.22 g/mol. Its IUPAC name is 3-amino-1-(4,4,4-trifluorobutyl)pyrrolidine-3-carboxylic acid.
Analyze 3-amino-1-(4,4,4-trifluorobutyl)pyrrolidine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-1-(4,4,4-trifluorobutyl)pyrrolidine-3-carboxylic acid?
The IUPAC name of 3-amino-1-(4,4,4-trifluorobutyl)pyrrolidine-3-carboxylic acid (CID 107324867) is 3-amino-1-(4,4,4-trifluorobutyl)pyrrolidine-3-carboxylic acid.
What is the SMILES notation for 3-amino-1-(4,4,4-trifluorobutyl)pyrrolidine-3-carboxylic acid?
The canonical SMILES for 3-amino-1-(4,4,4-trifluorobutyl)pyrrolidine-3-carboxylic acid is NC1(C(=O)O)CCN(CCCC(F)(F)F)C1.
What is the InChIKey of 3-amino-1-(4,4,4-trifluorobutyl)pyrrolidine-3-carboxylic acid?
The InChIKey is RUWVMWRCLBNCSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15F3N2O2/c10-9(11,12)2-1-4-14-5-3-8(13,6-14)7(15)16/h1-6,13H2,(H,15,16).
What are the key properties of 3-amino-1-(4,4,4-trifluorobutyl)pyrrolidine-3-carboxylic acid?
3-amino-1-(4,4,4-trifluorobutyl)pyrrolidine-3-carboxylic acid has a molecular weight of 240.22 g/mol, XLogP of 0.82, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-1-(4,4,4-trifluorobutyl)pyrrolidine-3-carboxylic acid is sourced from PubChem (CID 107324867), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).