C15H22N2O2 — CID 107325026
3-amino-1-(4-phenylbutyl)pyrrolidine-3-carboxylic acid (PubChem CID 107325026) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is 3-amino-1-(4-phenylbutyl)pyrrolidine-3-carboxylic acid.
| Compound Name | 3-amino-1-(4-phenylbutyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 107325026 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | 3-amino-1-(4-phenylbutyl)pyrrolidine-3-carboxylic acid |
| SMILES | NC1(C(=O)O)CCN(CCCCc2ccccc2)C1 |
| InChI | InChI=1S/C15H22N2O2/c16-15(14(18)19)9-11-17(12-15)10-5-4-8-13-6-2-1-3-7-13/h1-3,6-7H,4-5,8-12,16H2,(H,18,19) |
| InChIKey | JQDIEJAARZWPKU-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|