C17H24N2O4 — CID 22369490
4-amino-1-(5-phenylpentyl)pyrrolidine-2,4-dicarboxylic acid (PubChem CID 22369490) has the molecular formula C17H24N2O4 and a molecular weight of 320.39 g/mol. Its IUPAC name is 4-amino-1-(5-phenylpentyl)pyrrolidine-2,4-dicarboxylic acid.
| Compound Name | 4-amino-1-(5-phenylpentyl)pyrrolidine-2,4-dicarboxylic acid |
|---|---|
| PubChem CID | 22369490 |
| Molecular Formula | C17H24N2O4 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | 4-amino-1-(5-phenylpentyl)pyrrolidine-2,4-dicarboxylic acid |
| SMILES | NC1(C(=O)O)CC(C(=O)O)N(CCCCCc2ccccc2)C1 |
| InChI | InChI=1S/C17H24N2O4/c18-17(16(22)23)11-14(15(20)21)19(12-17)10-6-2-5-9-13-7-3-1-4-8-13/h1,3-4,7-8,14H,2,5-6,9-12,18H2,(H,20,21)(H,22,23) |
| InChIKey | VMHMSOIIEQVKTD-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|