C17H26O4 — CID 10732563
5-(4-tert-butylcyclohexen-1-yl)-2,2,5-trimethyl-1,3-dioxane-4,6-dione (PubChem CID 10732563) has the molecular formula C17H26O4 and a molecular weight of 294.39 g/mol. Its IUPAC name is 5-(4-tert-butylcyclohexen-1-yl)-2,2,5-trimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-(4-tert-butylcyclohexen-1-yl)-2,2,5-trimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 10732563 |
| Molecular Formula | C17H26O4 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | 5-(4-tert-butylcyclohexen-1-yl)-2,2,5-trimethyl-1,3-dioxane-4,6-dione |
| SMILES | CC1(C)OC(=O)C(C)(C2=CCC(C(C)(C)C)CC2)C(=O)O1 |
| InChI | InChI=1S/C17H26O4/c1-15(2,3)11-7-9-12(10-8-11)17(6)13(18)20-16(4,5)21-14(17)19/h9,11H,7-8,10H2,1-6H3 |
| InChIKey | VYHJLAOHPAGOAP-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|