C16H22O4 — CID 68723030
9,9,12-trimethyl-8,10-dioxadispiro[4.0.56.45]pentadec-13-ene-7,11-dione (PubChem CID 68723030) has the molecular formula C16H22O4 and a molecular weight of 278.35 g/mol. Its IUPAC name is 9,9,12-trimethyl-8,10-dioxadispiro[4.0.56.45]pentadec-13-ene-7,11-dione.
| Compound Name | 9,9,12-trimethyl-8,10-dioxadispiro[4.0.56.45]pentadec-13-ene-7,11-dione |
|---|---|
| PubChem CID | 68723030 |
| Molecular Formula | C16H22O4 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | 9,9,12-trimethyl-8,10-dioxadispiro[4.0.56.45]pentadec-13-ene-7,11-dione |
| SMILES | CC1C=CCC2(CCCC2)C12C(=O)OC(C)(C)OC2=O |
| InChI | InChI=1S/C16H22O4/c1-11-7-6-10-15(8-4-5-9-15)16(11)12(17)19-14(2,3)20-13(16)18/h6-7,11H,4-5,8-10H2,1-3H3 |
| InChIKey | PPSNRBBGAJWCTD-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|