C12H14O4 — CID 44543507
(1'R,4'R)-2,2-dimethylspiro[1,3-dioxane-5,5'-bicyclo[2.2.1]hept-2-ene]-4,6-dione (PubChem CID 44543507) has the molecular formula C12H14O4 and a molecular weight of 222.24 g/mol. Its IUPAC name is (1'R,4'R)-2,2-dimethylspiro[1,3-dioxane-5,5'-bicyclo[2.2.1]hept-2-ene]-4,6-dione.
| Compound Name | (1'R,4'R)-2,2-dimethylspiro[1,3-dioxane-5,5'-bicyclo[2.2.1]hept-2-ene]-4,6-dione |
|---|---|
| PubChem CID | 44543507 |
| Molecular Formula | C12H14O4 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | (1'R,4'R)-2,2-dimethylspiro[1,3-dioxane-5,5'-bicyclo[2.2.1]hept-2-ene]-4,6-dione |
| SMILES | CC1(C)OC(=O)C2(C[C@@H]3C=C[C@H]2C3)C(=O)O1 |
| InChI | InChI=1S/C12H14O4/c1-11(2)15-9(13)12(10(14)16-11)6-7-3-4-8(12)5-7/h3-4,7-8H,5-6H2,1-2H3/t7-,8+/m1/s1 |
| InChIKey | GPSZDYWTKQFACJ-SFYZADRCSA-N |
| XLogP | 1.40 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|