C10H13FN2O4S — CID 107326378
4-fluoro-N,N,2,6-tetramethyl-3-nitrobenzenesulfonamide (PubChem CID 107326378) has the molecular formula C10H13FN2O4S and a molecular weight of 276.29 g/mol. Its IUPAC name is 4-fluoro-N,N,2,6-tetramethyl-3-nitrobenzenesulfonamide.
| Compound Name | 4-fluoro-N,N,2,6-tetramethyl-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 107326378 |
| Molecular Formula | C10H13FN2O4S |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.06 |
| IUPAC Name | 4-fluoro-N,N,2,6-tetramethyl-3-nitrobenzenesulfonamide |
| SMILES | Cc1cc(F)c([N+](=O)[O-])c(C)c1S(=O)(=O)N(C)C |
| InChI | InChI=1S/C10H13FN2O4S/c1-6-5-8(11)9(13(14)15)7(2)10(6)18(16,17)12(3)4/h5H,1-4H3 |
| InChIKey | OEXGDZVACLUAFK-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|