C15H25N3O2S — CID 107328129
[3,5-dimethyl-4-(3-propylpyrrolidin-1-yl)sulfonylphenyl]hydrazine (PubChem CID 107328129) has the molecular formula C15H25N3O2S and a molecular weight of 311.45 g/mol. Its IUPAC name is [3,5-dimethyl-4-(3-propylpyrrolidin-1-yl)sulfonylphenyl]hydrazine.
| Compound Name | [3,5-dimethyl-4-(3-propylpyrrolidin-1-yl)sulfonylphenyl]hydrazine |
|---|---|
| PubChem CID | 107328129 |
| Molecular Formula | C15H25N3O2S |
| Molecular Weight | 311.45 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | [3,5-dimethyl-4-(3-propylpyrrolidin-1-yl)sulfonylphenyl]hydrazine |
| SMILES | CCCC1CCN(S(=O)(=O)c2c(C)cc(NN)cc2C)C1 |
| InChI | InChI=1S/C15H25N3O2S/c1-4-5-13-6-7-18(10-13)21(19,20)15-11(2)8-14(17-16)9-12(15)3/h8-9,13,17H,4-7,10,16H2,1-3H3 |
| InChIKey | AVLXTINYEJEFAS-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.45 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|