C13H18N2O2S2 — CID 10732854
4-[[4-(dimethylamino)phenyl]carbamothioylsulfanyl]butanoic acid (PubChem CID 10732854) has the molecular formula C13H18N2O2S2 and a molecular weight of 298.43 g/mol. Its IUPAC name is 4-[[4-(dimethylamino)phenyl]carbamothioylsulfanyl]butanoic acid.
| Compound Name | 4-[[4-(dimethylamino)phenyl]carbamothioylsulfanyl]butanoic acid |
|---|---|
| PubChem CID | 10732854 |
| Molecular Formula | C13H18N2O2S2 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | 4-[[4-(dimethylamino)phenyl]carbamothioylsulfanyl]butanoic acid |
| SMILES | CN(C)c1ccc(NC(=S)SCCCC(=O)O)cc1 |
| InChI | InChI=1S/C13H18N2O2S2/c1-15(2)11-7-5-10(6-8-11)14-13(18)19-9-3-4-12(16)17/h5-8H,3-4,9H2,1-2H3,(H,14,18)(H,16,17) |
| InChIKey | OQQMIDXURZQPMS-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|