C18H21NO3 — CID 10732904
N-(1,4-dioxaspiro[4.5]dec-7-en-8-yl)-N-prop-2-enylbenzamide (PubChem CID 10732904) has the molecular formula C18H21NO3 and a molecular weight of 299.37 g/mol. Its IUPAC name is N-(1,4-dioxaspiro[4.5]dec-7-en-8-yl)-N-prop-2-enylbenzamide.
| Compound Name | N-(1,4-dioxaspiro[4.5]dec-7-en-8-yl)-N-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 10732904 |
| Molecular Formula | C18H21NO3 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | N-(1,4-dioxaspiro[4.5]dec-7-en-8-yl)-N-prop-2-enylbenzamide |
| SMILES | C=CCN(C(=O)c1ccccc1)C1=CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C18H21NO3/c1-2-12-19(17(20)15-6-4-3-5-7-15)16-8-10-18(11-9-16)21-13-14-22-18/h2-8H,1,9-14H2 |
| InChIKey | ITYRYDSYEKUSSU-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|