C14H19BrFNO2S — CID 107329415
N-[[1-(2-bromoethyl)cyclopropyl]methyl]-4-fluoro-2,6-dimethylbenzenesulfonamide (PubChem CID 107329415) has the molecular formula C14H19BrFNO2S and a molecular weight of 364.28 g/mol. Its IUPAC name is N-[[1-(2-bromoethyl)cyclopropyl]methyl]-4-fluoro-2,6-dimethylbenzenesulfonamide.
| Compound Name | N-[[1-(2-bromoethyl)cyclopropyl]methyl]-4-fluoro-2,6-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 107329415 |
| Molecular Formula | C14H19BrFNO2S |
| Molecular Weight | 364.28 g/mol |
| Exact Mass | 363.03 |
| IUPAC Name | N-[[1-(2-bromoethyl)cyclopropyl]methyl]-4-fluoro-2,6-dimethylbenzenesulfonamide |
| SMILES | Cc1cc(F)cc(C)c1S(=O)(=O)NCC1(CCBr)CC1 |
| InChI | InChI=1S/C14H19BrFNO2S/c1-10-7-12(16)8-11(2)13(10)20(18,19)17-9-14(3-4-14)5-6-15/h7-8,17H,3-6,9H2,1-2H3 |
| InChIKey | PFABTCDEQZKETR-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.28 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|