C11H14ClN3OS — CID 107329698
5-chloro-N-[(1-methylsulfanylcyclobutyl)methyl]pyrazine-2-carboxamide (PubChem CID 107329698) has the molecular formula C11H14ClN3OS and a molecular weight of 271.77 g/mol. Its IUPAC name is 5-chloro-N-[(1-methylsulfanylcyclobutyl)methyl]pyrazine-2-carboxamide.
| Compound Name | 5-chloro-N-[(1-methylsulfanylcyclobutyl)methyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 107329698 |
| Molecular Formula | C11H14ClN3OS |
| Molecular Weight | 271.77 g/mol |
| Exact Mass | 271.05 |
| IUPAC Name | 5-chloro-N-[(1-methylsulfanylcyclobutyl)methyl]pyrazine-2-carboxamide |
| SMILES | CSC1(CNC(=O)c2cnc(Cl)cn2)CCC1 |
| InChI | InChI=1S/C11H14ClN3OS/c1-17-11(3-2-4-11)7-15-10(16)8-5-14-9(12)6-13-8/h5-6H,2-4,7H2,1H3,(H,15,16) |
| InChIKey | PTEDGCBMAWZOSX-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.77 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |