C13H25N3O4 — CID 107330119
2-(carbamoylamino)-N-[(3-hydroxy-2-methyloxolan-3-yl)methyl]-3-methylpentanamide (PubChem CID 107330119) has the molecular formula C13H25N3O4 and a molecular weight of 287.36 g/mol. Its IUPAC name is 2-(carbamoylamino)-N-[(3-hydroxy-2-methyloxolan-3-yl)methyl]-3-methylpentanamide.
| Compound Name | 2-(carbamoylamino)-N-[(3-hydroxy-2-methyloxolan-3-yl)methyl]-3-methylpentanamide |
|---|---|
| PubChem CID | 107330119 |
| Molecular Formula | C13H25N3O4 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.18 |
| IUPAC Name | 2-(carbamoylamino)-N-[(3-hydroxy-2-methyloxolan-3-yl)methyl]-3-methylpentanamide |
| SMILES | CCC(C)C(NC(N)=O)C(=O)NCC1(O)CCOC1C |
| InChI | InChI=1S/C13H25N3O4/c1-4-8(2)10(16-12(14)18)11(17)15-7-13(19)5-6-20-9(13)3/h8-10,19H,4-7H2,1-3H3,(H,15,17)(H3,14,16,18) |
| InChIKey | KMOGFYDXDIIIIG-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |