C15H29N3O3 — CID 65120019
2-(carbamoylamino)-N-[(1-hydroxy-4-methylcyclohexyl)methyl]-3-methylpentanamide (PubChem CID 65120019) has the molecular formula C15H29N3O3 and a molecular weight of 299.42 g/mol. Its IUPAC name is 2-(carbamoylamino)-N-[(1-hydroxy-4-methylcyclohexyl)methyl]-3-methylpentanamide.
| Compound Name | 2-(carbamoylamino)-N-[(1-hydroxy-4-methylcyclohexyl)methyl]-3-methylpentanamide |
|---|---|
| PubChem CID | 65120019 |
| Molecular Formula | C15H29N3O3 |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.22 |
| IUPAC Name | 2-(carbamoylamino)-N-[(1-hydroxy-4-methylcyclohexyl)methyl]-3-methylpentanamide |
| SMILES | CCC(C)C(NC(N)=O)C(=O)NCC1(O)CCC(C)CC1 |
| InChI | InChI=1S/C15H29N3O3/c1-4-11(3)12(18-14(16)20)13(19)17-9-15(21)7-5-10(2)6-8-15/h10-12,21H,4-9H2,1-3H3,(H,17,19)(H3,16,18,20) |
| InChIKey | PIUDJCXLQDEMHB-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |