C17H19NO4 — CID 10733041
(1'S,6'R)-7'-benzylspiro[1,3-dioxolane-2,4'-7-azabicyclo[4.2.1]nonane]-8',9'-dione (PubChem CID 10733041) has the molecular formula C17H19NO4 and a molecular weight of 301.34 g/mol. Its IUPAC name is (1'S,6'R)-7'-benzylspiro[1,3-dioxolane-2,4'-7-azabicyclo[4.2.1]nonane]-8',9'-dione.
| Compound Name | (1'S,6'R)-7'-benzylspiro[1,3-dioxolane-2,4'-7-azabicyclo[4.2.1]nonane]-8',9'-dione |
|---|---|
| PubChem CID | 10733041 |
| Molecular Formula | C17H19NO4 |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | (1'S,6'R)-7'-benzylspiro[1,3-dioxolane-2,4'-7-azabicyclo[4.2.1]nonane]-8',9'-dione |
| SMILES | O=C1[C@@H]2CCC3(C[C@H]1N(Cc1ccccc1)C2=O)OCCO3 |
| InChI | InChI=1S/C17H19NO4/c19-15-13-6-7-17(21-8-9-22-17)10-14(15)18(16(13)20)11-12-4-2-1-3-5-12/h1-5,13-14H,6-11H2/t13-,14+/m0/s1 |
| InChIKey | SOKAVRRIGYZMMN-UONOGXRCSA-N |
| XLogP | 1.51 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|