C24H29NO3 — CID 22008780
1,5-dibenzyl-3-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]pyrrolidin-2-one (PubChem CID 22008780) has the molecular formula C24H29NO3 and a molecular weight of 379.50 g/mol. Its IUPAC name is 1,5-dibenzyl-3-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]pyrrolidin-2-one.
| Compound Name | 1,5-dibenzyl-3-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 22008780 |
| Molecular Formula | C24H29NO3 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.21 |
| IUPAC Name | 1,5-dibenzyl-3-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]pyrrolidin-2-one |
| SMILES | CC1(CCC2CC(Cc3ccccc3)N(Cc3ccccc3)C2=O)OCCO1 |
| InChI | InChI=1S/C24H29NO3/c1-24(27-14-15-28-24)13-12-21-17-22(16-19-8-4-2-5-9-19)25(23(21)26)18-20-10-6-3-7-11-20/h2-11,21-22H,12-18H2,1H3 |
| InChIKey | KRIBZWGFPQCHBO-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |