C14H15N3 — CID 107331160
4-(2-phenylpyrazol-3-yl)-1,2,3,6-tetrahydropyridine (PubChem CID 107331160) has the molecular formula C14H15N3 and a molecular weight of 225.30 g/mol. Its IUPAC name is 4-(2-phenylpyrazol-3-yl)-1,2,3,6-tetrahydropyridine.
| Compound Name | 4-(2-phenylpyrazol-3-yl)-1,2,3,6-tetrahydropyridine |
|---|---|
| PubChem CID | 107331160 |
| Molecular Formula | C14H15N3 |
| Molecular Weight | 225.30 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | 4-(2-phenylpyrazol-3-yl)-1,2,3,6-tetrahydropyridine |
| SMILES | C1=C(c2ccnn2-c2ccccc2)CCNC1 |
| InChI | InChI=1S/C14H15N3/c1-2-4-13(5-3-1)17-14(8-11-16-17)12-6-9-15-10-7-12/h1-6,8,11,15H,7,9-10H2 |
| InChIKey | IKTHVOCZKZGCEN-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.30 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |