C10H11FN2 — CID 107335472
3-(2,5-dihydropyrrol-1-yl)-5-fluoroaniline (PubChem CID 107335472) has the molecular formula C10H11FN2 and a molecular weight of 178.21 g/mol. Its IUPAC name is 3-(2,5-dihydropyrrol-1-yl)-5-fluoroaniline.
| Compound Name | 3-(2,5-dihydropyrrol-1-yl)-5-fluoroaniline |
|---|---|
| PubChem CID | 107335472 |
| Molecular Formula | C10H11FN2 |
| Molecular Weight | 178.21 g/mol |
| Exact Mass | 178.09 |
| IUPAC Name | 3-(2,5-dihydropyrrol-1-yl)-5-fluoroaniline |
| SMILES | Nc1cc(F)cc(N2CC=CC2)c1 |
| InChI | InChI=1S/C10H11FN2/c11-8-5-9(12)7-10(6-8)13-3-1-2-4-13/h1-2,5-7H,3-4,12H2 |
| InChIKey | FBRPDAOQIYGBRJ-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.21 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|