C12H12FN5O3 — CID 107335528
N-(3-fluoro-5-nitrophenyl)-5-propyl-1H-1,2,4-triazole-3-carboxamide (PubChem CID 107335528) has the molecular formula C12H12FN5O3 and a molecular weight of 293.26 g/mol. Its IUPAC name is N-(3-fluoro-5-nitrophenyl)-5-propyl-1H-1,2,4-triazole-3-carboxamide.
| Compound Name | N-(3-fluoro-5-nitrophenyl)-5-propyl-1H-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 107335528 |
| Molecular Formula | C12H12FN5O3 |
| Molecular Weight | 293.26 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | N-(3-fluoro-5-nitrophenyl)-5-propyl-1H-1,2,4-triazole-3-carboxamide |
| SMILES | CCCc1nc(C(=O)Nc2cc(F)cc([N+](=O)[O-])c2)n[nH]1 |
| InChI | InChI=1S/C12H12FN5O3/c1-2-3-10-15-11(17-16-10)12(19)14-8-4-7(13)5-9(6-8)18(20)21/h4-6H,2-3H2,1H3,(H,14,19)(H,15,16,17) |
| InChIKey | QLKXRGPHUGPNGO-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 113.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.26 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|