C12H11FN4O3 — CID 107335521
N-(3-fluoro-5-nitrophenyl)-3,5-dimethyl-1H-pyrazole-4-carboxamide (PubChem CID 107335521) has the molecular formula C12H11FN4O3 and a molecular weight of 278.24 g/mol. Its IUPAC name is N-(3-fluoro-5-nitrophenyl)-3,5-dimethyl-1H-pyrazole-4-carboxamide.
| Compound Name | N-(3-fluoro-5-nitrophenyl)-3,5-dimethyl-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 107335521 |
| Molecular Formula | C12H11FN4O3 |
| Molecular Weight | 278.24 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | N-(3-fluoro-5-nitrophenyl)-3,5-dimethyl-1H-pyrazole-4-carboxamide |
| SMILES | Cc1n[nH]c(C)c1C(=O)Nc1cc(F)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H11FN4O3/c1-6-11(7(2)16-15-6)12(18)14-9-3-8(13)4-10(5-9)17(19)20/h3-5H,1-2H3,(H,14,18)(H,15,16) |
| InChIKey | OWKWXSUQGWJMBE-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 100.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.24 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|