C12H11Cl2N3O — CID 43582492
N-(3,5-dichlorophenyl)-3,5-dimethyl-1H-pyrazole-4-carboxamide (PubChem CID 43582492) has the molecular formula C12H11Cl2N3O and a molecular weight of 284.15 g/mol. Its IUPAC name is N-(3,5-dichlorophenyl)-3,5-dimethyl-1H-pyrazole-4-carboxamide.
| Compound Name | N-(3,5-dichlorophenyl)-3,5-dimethyl-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 43582492 |
| Molecular Formula | C12H11Cl2N3O |
| Molecular Weight | 284.15 g/mol |
| Exact Mass | 283.03 |
| IUPAC Name | N-(3,5-dichlorophenyl)-3,5-dimethyl-1H-pyrazole-4-carboxamide |
| SMILES | Cc1n[nH]c(C)c1C(=O)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C12H11Cl2N3O/c1-6-11(7(2)17-16-6)12(18)15-10-4-8(13)3-9(14)5-10/h3-5H,1-2H3,(H,15,18)(H,16,17) |
| InChIKey | QPTSVKWGHWDWLE-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.15 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |