C13H13ClN4O2 — CID 61274098
N-(5-carbamoyl-2-chlorophenyl)-3,5-dimethyl-1H-pyrazole-4-carboxamide (PubChem CID 61274098) has the molecular formula C13H13ClN4O2 and a molecular weight of 292.73 g/mol. Its IUPAC name is N-(5-carbamoyl-2-chlorophenyl)-3,5-dimethyl-1H-pyrazole-4-carboxamide.
| Compound Name | N-(5-carbamoyl-2-chlorophenyl)-3,5-dimethyl-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 61274098 |
| Molecular Formula | C13H13ClN4O2 |
| Molecular Weight | 292.73 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | N-(5-carbamoyl-2-chlorophenyl)-3,5-dimethyl-1H-pyrazole-4-carboxamide |
| SMILES | Cc1n[nH]c(C)c1C(=O)Nc1cc(C(N)=O)ccc1Cl |
| InChI | InChI=1S/C13H13ClN4O2/c1-6-11(7(2)18-17-6)13(20)16-10-5-8(12(15)19)3-4-9(10)14/h3-5H,1-2H3,(H2,15,19)(H,16,20)(H,17,18) |
| InChIKey | JOBVWZIKXTUPQY-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.73 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |