C12H11BrIN3O — CID 113366812
N-(5-bromo-2-iodophenyl)-3,5-dimethyl-1H-pyrazole-4-carboxamide (PubChem CID 113366812) has the molecular formula C12H11BrIN3O and a molecular weight of 420.05 g/mol. Its IUPAC name is N-(5-bromo-2-iodophenyl)-3,5-dimethyl-1H-pyrazole-4-carboxamide.
| Compound Name | N-(5-bromo-2-iodophenyl)-3,5-dimethyl-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 113366812 |
| Molecular Formula | C12H11BrIN3O |
| Molecular Weight | 420.05 g/mol |
| Exact Mass | 418.91 |
| IUPAC Name | N-(5-bromo-2-iodophenyl)-3,5-dimethyl-1H-pyrazole-4-carboxamide |
| SMILES | Cc1n[nH]c(C)c1C(=O)Nc1cc(Br)ccc1I |
| InChI | InChI=1S/C12H11BrIN3O/c1-6-11(7(2)17-16-6)12(18)15-10-5-8(13)3-4-9(10)14/h3-5H,1-2H3,(H,15,18)(H,16,17) |
| InChIKey | VCHBYNREOXJDQJ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.05 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|