C13H11Br2N3O3 — CID 63111891
3,5-dibromo-2-[(3,5-dimethyl-1H-pyrazole-4-carbonyl)amino]benzoic acid (PubChem CID 63111891) has the molecular formula C13H11Br2N3O3 and a molecular weight of 417.06 g/mol. Its IUPAC name is 3,5-dibromo-2-[(3,5-dimethyl-1H-pyrazole-4-carbonyl)amino]benzoic acid.
| Compound Name | 3,5-dibromo-2-[(3,5-dimethyl-1H-pyrazole-4-carbonyl)amino]benzoic acid |
|---|---|
| PubChem CID | 63111891 |
| Molecular Formula | C13H11Br2N3O3 |
| Molecular Weight | 417.06 g/mol |
| Exact Mass | 414.92 |
| IUPAC Name | 3,5-dibromo-2-[(3,5-dimethyl-1H-pyrazole-4-carbonyl)amino]benzoic acid |
| SMILES | Cc1n[nH]c(C)c1C(=O)Nc1c(Br)cc(Br)cc1C(=O)O |
| InChI | InChI=1S/C13H11Br2N3O3/c1-5-10(6(2)18-17-5)12(19)16-11-8(13(20)21)3-7(14)4-9(11)15/h3-4H,1-2H3,(H,16,19)(H,17,18)(H,20,21) |
| InChIKey | HDAPUSJCNRGXIW-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.06 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |