C11H9BrF3N3O — CID 107336923
1-[3-bromo-4-(trifluoromethoxy)phenyl]-N-methylimidazol-2-amine (PubChem CID 107336923) has the molecular formula C11H9BrF3N3O and a molecular weight of 336.11 g/mol. Its IUPAC name is 1-[3-bromo-4-(trifluoromethoxy)phenyl]-N-methylimidazol-2-amine.
| Compound Name | 1-[3-bromo-4-(trifluoromethoxy)phenyl]-N-methylimidazol-2-amine |
|---|---|
| PubChem CID | 107336923 |
| Molecular Formula | C11H9BrF3N3O |
| Molecular Weight | 336.11 g/mol |
| Exact Mass | 334.99 |
| IUPAC Name | 1-[3-bromo-4-(trifluoromethoxy)phenyl]-N-methylimidazol-2-amine |
| SMILES | CNc1nccn1-c1ccc(OC(F)(F)F)c(Br)c1 |
| InChI | InChI=1S/C11H9BrF3N3O/c1-16-10-17-4-5-18(10)7-2-3-9(8(12)6-7)19-11(13,14)15/h2-6H,1H3,(H,16,17) |
| InChIKey | NQZUVYQYCUVFFA-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.11 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |