C15H22N2O3S — CID 107337125
6-amino-N-(2-methylcyclopentyl)-3,4-dihydro-2H-chromene-8-sulfonamide (PubChem CID 107337125) has the molecular formula C15H22N2O3S and a molecular weight of 310.42 g/mol. Its IUPAC name is 6-amino-N-(2-methylcyclopentyl)-3,4-dihydro-2H-chromene-8-sulfonamide.
| Compound Name | 6-amino-N-(2-methylcyclopentyl)-3,4-dihydro-2H-chromene-8-sulfonamide |
|---|---|
| PubChem CID | 107337125 |
| Molecular Formula | C15H22N2O3S |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 6-amino-N-(2-methylcyclopentyl)-3,4-dihydro-2H-chromene-8-sulfonamide |
| SMILES | CC1CCCC1NS(=O)(=O)c1cc(N)cc2c1OCCC2 |
| InChI | InChI=1S/C15H22N2O3S/c1-10-4-2-6-13(10)17-21(18,19)14-9-12(16)8-11-5-3-7-20-15(11)14/h8-10,13,17H,2-7,16H2,1H3 |
| InChIKey | AFEWRJWCVQRTIO-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|