C11H17N3O5S2 — CID 107337040
6-amino-N-(2-sulfamoylethyl)-3,4-dihydro-2H-chromene-8-sulfonamide (PubChem CID 107337040) has the molecular formula C11H17N3O5S2 and a molecular weight of 335.41 g/mol. Its IUPAC name is 6-amino-N-(2-sulfamoylethyl)-3,4-dihydro-2H-chromene-8-sulfonamide.
| Compound Name | 6-amino-N-(2-sulfamoylethyl)-3,4-dihydro-2H-chromene-8-sulfonamide |
|---|---|
| PubChem CID | 107337040 |
| Molecular Formula | C11H17N3O5S2 |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.06 |
| IUPAC Name | 6-amino-N-(2-sulfamoylethyl)-3,4-dihydro-2H-chromene-8-sulfonamide |
| SMILES | Nc1cc2c(c(S(=O)(=O)NCCS(N)(=O)=O)c1)OCCC2 |
| InChI | InChI=1S/C11H17N3O5S2/c12-9-6-8-2-1-4-19-11(8)10(7-9)21(17,18)14-3-5-20(13,15)16/h6-7,14H,1-5,12H2,(H2,13,15,16) |
| InChIKey | SRYXTBBMZGMLHQ-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 141.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|