C14H22N2O4S — CID 107337158
6-amino-N-(4-hydroxy-2-methylbutyl)-3,4-dihydro-2H-chromene-8-sulfonamide (PubChem CID 107337158) has the molecular formula C14H22N2O4S and a molecular weight of 314.41 g/mol. Its IUPAC name is 6-amino-N-(4-hydroxy-2-methylbutyl)-3,4-dihydro-2H-chromene-8-sulfonamide.
| Compound Name | 6-amino-N-(4-hydroxy-2-methylbutyl)-3,4-dihydro-2H-chromene-8-sulfonamide |
|---|---|
| PubChem CID | 107337158 |
| Molecular Formula | C14H22N2O4S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | 6-amino-N-(4-hydroxy-2-methylbutyl)-3,4-dihydro-2H-chromene-8-sulfonamide |
| SMILES | CC(CCO)CNS(=O)(=O)c1cc(N)cc2c1OCCC2 |
| InChI | InChI=1S/C14H22N2O4S/c1-10(4-5-17)9-16-21(18,19)13-8-12(15)7-11-3-2-6-20-14(11)13/h7-8,10,16-17H,2-6,9,15H2,1H3 |
| InChIKey | HDQQWECNUCJCAK-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|