C12H13N5O3S — CID 107337282
6-amino-N-(1,2,4-triazin-3-yl)-3,4-dihydro-2H-chromene-8-sulfonamide (PubChem CID 107337282) has the molecular formula C12H13N5O3S and a molecular weight of 307.34 g/mol. Its IUPAC name is 6-amino-N-(1,2,4-triazin-3-yl)-3,4-dihydro-2H-chromene-8-sulfonamide.
| Compound Name | 6-amino-N-(1,2,4-triazin-3-yl)-3,4-dihydro-2H-chromene-8-sulfonamide |
|---|---|
| PubChem CID | 107337282 |
| Molecular Formula | C12H13N5O3S |
| Molecular Weight | 307.34 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | 6-amino-N-(1,2,4-triazin-3-yl)-3,4-dihydro-2H-chromene-8-sulfonamide |
| SMILES | Nc1cc2c(c(S(=O)(=O)Nc3nccnn3)c1)OCCC2 |
| InChI | InChI=1S/C12H13N5O3S/c13-9-6-8-2-1-5-20-11(8)10(7-9)21(18,19)17-12-14-3-4-15-16-12/h3-4,6-7H,1-2,5,13H2,(H,14,16,17) |
| InChIKey | OAZFSCCERQBHQV-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 120.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.34 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|