C15H21N3O3 — CID 107337538
ethyl 1-[2-(5-amino-2-pyridinyl)acetyl]piperidine-4-carboxylate (PubChem CID 107337538) has the molecular formula C15H21N3O3 and a molecular weight of 291.35 g/mol. Its IUPAC name is ethyl 1-[2-(5-amino-2-pyridinyl)acetyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[2-(5-amino-2-pyridinyl)acetyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 107337538 |
| Molecular Formula | C15H21N3O3 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | ethyl 1-[2-(5-amino-2-pyridinyl)acetyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)Cc2ccc(N)cn2)CC1 |
| InChI | InChI=1S/C15H21N3O3/c1-2-21-15(20)11-5-7-18(8-6-11)14(19)9-13-4-3-12(16)10-17-13/h3-4,10-11H,2,5-9,16H2,1H3 |
| InChIKey | UCIZWBXVPDFBRW-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 85.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |