C14H22ClN3O — CID 120632859
2-(5-amino-2-pyridinyl)-1-(2-methylazepan-1-yl)ethanone;hydrochloride (PubChem CID 120632859) has the molecular formula C14H22ClN3O and a molecular weight of 283.80 g/mol. Its IUPAC name is 2-(5-amino-2-pyridinyl)-1-(2-methylazepan-1-yl)ethanone;hydrochloride.
| Compound Name | 2-(5-amino-2-pyridinyl)-1-(2-methylazepan-1-yl)ethanone;hydrochloride |
|---|---|
| PubChem CID | 120632859 |
| Molecular Formula | C14H22ClN3O |
| Molecular Weight | 283.80 g/mol |
| Exact Mass | 283.15 |
| IUPAC Name | 2-(5-amino-2-pyridinyl)-1-(2-methylazepan-1-yl)ethanone;hydrochloride |
| SMILES | CC1CCCCCN1C(=O)Cc1ccc(N)cn1.Cl |
| InChI | InChI=1S/C14H21N3O.ClH/c1-11-5-3-2-4-8-17(11)14(18)9-13-7-6-12(15)10-16-13;/h6-7,10-11H,2-5,8-9,15H2,1H3;1H |
| InChIKey | PILQXTKTYYIIGW-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.80 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |