C16H26Cl2N4O — CID 120641372
2-(5-amino-2-pyridinyl)-1-(4-pyrrolidin-1-ylpiperidin-1-yl)ethanone;dihydrochloride (PubChem CID 120641372) has the molecular formula C16H26Cl2N4O and a molecular weight of 361.32 g/mol. Its IUPAC name is 2-(5-amino-2-pyridinyl)-1-(4-pyrrolidin-1-ylpiperidin-1-yl)ethanone;dihydrochloride.
| Compound Name | 2-(5-amino-2-pyridinyl)-1-(4-pyrrolidin-1-ylpiperidin-1-yl)ethanone;dihydrochloride |
|---|---|
| PubChem CID | 120641372 |
| Molecular Formula | C16H26Cl2N4O |
| Molecular Weight | 361.32 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | 2-(5-amino-2-pyridinyl)-1-(4-pyrrolidin-1-ylpiperidin-1-yl)ethanone;dihydrochloride |
| SMILES | Cl.Cl.Nc1ccc(CC(=O)N2CCC(N3CCCC3)CC2)nc1 |
| InChI | InChI=1S/C16H24N4O.2ClH/c17-13-3-4-14(18-12-13)11-16(21)20-9-5-15(6-10-20)19-7-1-2-8-19;;/h3-4,12,15H,1-2,5-11,17H2;2*1H |
| InChIKey | RAEACIZZAHKLAI-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.32 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |