C15H20Cl2N6O — CID 120639461
2-(5-amino-2-pyridinyl)-1-(4-pyrimidin-2-ylpiperazin-1-yl)ethanone;dihydrochloride (PubChem CID 120639461) has the molecular formula C15H20Cl2N6O and a molecular weight of 371.27 g/mol. Its IUPAC name is 2-(5-amino-2-pyridinyl)-1-(4-pyrimidin-2-ylpiperazin-1-yl)ethanone;dihydrochloride.
| Compound Name | 2-(5-amino-2-pyridinyl)-1-(4-pyrimidin-2-ylpiperazin-1-yl)ethanone;dihydrochloride |
|---|---|
| PubChem CID | 120639461 |
| Molecular Formula | C15H20Cl2N6O |
| Molecular Weight | 371.27 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | 2-(5-amino-2-pyridinyl)-1-(4-pyrimidin-2-ylpiperazin-1-yl)ethanone;dihydrochloride |
| SMILES | Cl.Cl.Nc1ccc(CC(=O)N2CCN(c3ncccn3)CC2)nc1 |
| InChI | InChI=1S/C15H18N6O.2ClH/c16-12-2-3-13(19-11-12)10-14(22)20-6-8-21(9-7-20)15-17-4-1-5-18-15;;/h1-5,11H,6-10,16H2;2*1H |
| InChIKey | UXYJQPRYPZOIOX-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.27 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |