C15H21ClN4O2 — CID 120622960
1-[2-(5-amino-2-pyridinyl)acetyl]-N-cyclopropylpyrrolidine-2-carboxamide;hydrochloride (PubChem CID 120622960) has the molecular formula C15H21ClN4O2 and a molecular weight of 324.81 g/mol. Its IUPAC name is 1-[2-(5-amino-2-pyridinyl)acetyl]-N-cyclopropylpyrrolidine-2-carboxamide;hydrochloride.
| Compound Name | 1-[2-(5-amino-2-pyridinyl)acetyl]-N-cyclopropylpyrrolidine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 120622960 |
| Molecular Formula | C15H21ClN4O2 |
| Molecular Weight | 324.81 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | 1-[2-(5-amino-2-pyridinyl)acetyl]-N-cyclopropylpyrrolidine-2-carboxamide;hydrochloride |
| SMILES | Cl.Nc1ccc(CC(=O)N2CCCC2C(=O)NC2CC2)nc1 |
| InChI | InChI=1S/C15H20N4O2.ClH/c16-10-3-4-12(17-9-10)8-14(20)19-7-1-2-13(19)15(21)18-11-5-6-11;/h3-4,9,11,13H,1-2,5-8,16H2,(H,18,21);1H |
| InChIKey | JPCXGAGJYDACRW-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.81 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |