C13H21N3 — CID 107340030
6-[2-[cyclopentyl(methyl)amino]ethyl]pyridin-3-amine (PubChem CID 107340030) has the molecular formula C13H21N3 and a molecular weight of 219.33 g/mol. Its IUPAC name is 6-[2-[cyclopentyl(methyl)amino]ethyl]pyridin-3-amine.
| Compound Name | 6-[2-[cyclopentyl(methyl)amino]ethyl]pyridin-3-amine |
|---|---|
| PubChem CID | 107340030 |
| Molecular Formula | C13H21N3 |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.17 |
| IUPAC Name | 6-[2-[cyclopentyl(methyl)amino]ethyl]pyridin-3-amine |
| SMILES | CN(CCc1ccc(N)cn1)C1CCCC1 |
| InChI | InChI=1S/C13H21N3/c1-16(13-4-2-3-5-13)9-8-12-7-6-11(14)10-15-12/h6-7,10,13H,2-5,8-9,14H2,1H3 |
| InChIKey | WVADBVUVYNDBOE-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |