C15H27N3 — CID 107340097
6-[2-[bis(2-methylpropyl)amino]ethyl]pyridin-3-amine (PubChem CID 107340097) has the molecular formula C15H27N3 and a molecular weight of 249.40 g/mol. Its IUPAC name is 6-[2-[bis(2-methylpropyl)amino]ethyl]pyridin-3-amine.
| Compound Name | 6-[2-[bis(2-methylpropyl)amino]ethyl]pyridin-3-amine |
|---|---|
| PubChem CID | 107340097 |
| Molecular Formula | C15H27N3 |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.22 |
| IUPAC Name | 6-[2-[bis(2-methylpropyl)amino]ethyl]pyridin-3-amine |
| SMILES | CC(C)CN(CCc1ccc(N)cn1)CC(C)C |
| InChI | InChI=1S/C15H27N3/c1-12(2)10-18(11-13(3)4)8-7-15-6-5-14(16)9-17-15/h5-6,9,12-13H,7-8,10-11,16H2,1-4H3 |
| InChIKey | BYHXZGZEDBBLRJ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |