C14H19N3O3 — CID 107340676
2-[5-[(2-methylcyclopentyl)carbamoylamino]-2-pyridinyl]acetic acid (PubChem CID 107340676) has the molecular formula C14H19N3O3 and a molecular weight of 277.32 g/mol. Its IUPAC name is 2-[5-[(2-methylcyclopentyl)carbamoylamino]-2-pyridinyl]acetic acid.
| Compound Name | 2-[5-[(2-methylcyclopentyl)carbamoylamino]-2-pyridinyl]acetic acid |
|---|---|
| PubChem CID | 107340676 |
| Molecular Formula | C14H19N3O3 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.14 |
| IUPAC Name | 2-[5-[(2-methylcyclopentyl)carbamoylamino]-2-pyridinyl]acetic acid |
| SMILES | CC1CCCC1NC(=O)Nc1ccc(CC(=O)O)nc1 |
| InChI | InChI=1S/C14H19N3O3/c1-9-3-2-4-12(9)17-14(20)16-11-6-5-10(15-8-11)7-13(18)19/h5-6,8-9,12H,2-4,7H2,1H3,(H,18,19)(H2,16,17,20) |
| InChIKey | FNXWMNAXNQBQTD-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |