C13H18N4O3 — CID 107340537
2-[5-(piperidin-4-ylcarbamoylamino)-2-pyridinyl]acetic acid (PubChem CID 107340537) has the molecular formula C13H18N4O3 and a molecular weight of 278.31 g/mol. Its IUPAC name is 2-[5-(piperidin-4-ylcarbamoylamino)-2-pyridinyl]acetic acid.
| Compound Name | 2-[5-(piperidin-4-ylcarbamoylamino)-2-pyridinyl]acetic acid |
|---|---|
| PubChem CID | 107340537 |
| Molecular Formula | C13H18N4O3 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | 2-[5-(piperidin-4-ylcarbamoylamino)-2-pyridinyl]acetic acid |
| SMILES | O=C(O)Cc1ccc(NC(=O)NC2CCNCC2)cn1 |
| InChI | InChI=1S/C13H18N4O3/c18-12(19)7-10-1-2-11(8-15-10)17-13(20)16-9-3-5-14-6-4-9/h1-2,8-9,14H,3-7H2,(H,18,19)(H2,16,17,20) |
| InChIKey | BMISAZIJWQSFHL-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 103.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |