C11H9N3O6 — CID 107341180
2-[(5-methyl-1,2,4-oxadiazol-3-yl)methoxy]-6-nitrobenzoic acid (PubChem CID 107341180) has the molecular formula C11H9N3O6 and a molecular weight of 279.21 g/mol. Its IUPAC name is 2-[(5-methyl-1,2,4-oxadiazol-3-yl)methoxy]-6-nitrobenzoic acid.
| Compound Name | 2-[(5-methyl-1,2,4-oxadiazol-3-yl)methoxy]-6-nitrobenzoic acid |
|---|---|
| PubChem CID | 107341180 |
| Molecular Formula | C11H9N3O6 |
| Molecular Weight | 279.21 g/mol |
| Exact Mass | 279.05 |
| IUPAC Name | 2-[(5-methyl-1,2,4-oxadiazol-3-yl)methoxy]-6-nitrobenzoic acid |
| SMILES | Cc1nc(COc2cccc([N+](=O)[O-])c2C(=O)O)no1 |
| InChI | InChI=1S/C11H9N3O6/c1-6-12-9(13-20-6)5-19-8-4-2-3-7(14(17)18)10(8)11(15)16/h2-4H,5H2,1H3,(H,15,16) |
| InChIKey | PGULJDUYCGKRSP-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 128.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.21 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|