C8H9N3O — CID 107342126
1-(3-amino-4-pyridinyl)azetidin-2-one (PubChem CID 107342126) has the molecular formula C8H9N3O and a molecular weight of 163.18 g/mol. Its IUPAC name is 1-(3-amino-4-pyridinyl)azetidin-2-one.
| Compound Name | 1-(3-amino-4-pyridinyl)azetidin-2-one |
|---|---|
| PubChem CID | 107342126 |
| Molecular Formula | C8H9N3O |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.07 |
| IUPAC Name | 1-(3-amino-4-pyridinyl)azetidin-2-one |
| SMILES | Nc1cnccc1N1CCC1=O |
| InChI | InChI=1S/C8H9N3O/c9-6-5-10-3-1-7(6)11-4-2-8(11)12/h1,3,5H,2,4,9H2 |
| InChIKey | GXXJFFBFCPSNOL-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |