C15H30O5Si — CID 10734348
(3S)-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-(2-trimethylsilylethoxymethoxy)butanal (PubChem CID 10734348) has the molecular formula C15H30O5Si and a molecular weight of 318.49 g/mol. Its IUPAC name is (3S)-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-(2-trimethylsilylethoxymethoxy)butanal.
| Compound Name | (3S)-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-(2-trimethylsilylethoxymethoxy)butanal |
|---|---|
| PubChem CID | 10734348 |
| Molecular Formula | C15H30O5Si |
| Molecular Weight | 318.49 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | (3S)-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-(2-trimethylsilylethoxymethoxy)butanal |
| SMILES | CC1(C)OC[C@H](C[C@@H](CC=O)OCOCC[Si](C)(C)C)O1 |
| InChI | InChI=1S/C15H30O5Si/c1-15(2)19-11-14(20-15)10-13(6-7-16)18-12-17-8-9-21(3,4)5/h7,13-14H,6,8-12H2,1-5H3/t13-,14+/m1/s1 |
| InChIKey | UMAFBLVTIAUFPR-KGLIPLIRSA-N |
| XLogP | 2.81 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.49 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|