C15H30O5Si — CID 552050
2,2-dimethyl-5-[2-(2-trimethylsilylethoxymethoxy)propyl]-1,3-dioxolane-4-carbaldehyde (PubChem CID 552050) has the molecular formula C15H30O5Si and a molecular weight of 318.49 g/mol. Its IUPAC name is 2,2-dimethyl-5-[2-(2-trimethylsilylethoxymethoxy)propyl]-1,3-dioxolane-4-carbaldehyde.
| Compound Name | 2,2-dimethyl-5-[2-(2-trimethylsilylethoxymethoxy)propyl]-1,3-dioxolane-4-carbaldehyde |
|---|---|
| PubChem CID | 552050 |
| Molecular Formula | C15H30O5Si |
| Molecular Weight | 318.49 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | 2,2-dimethyl-5-[2-(2-trimethylsilylethoxymethoxy)propyl]-1,3-dioxolane-4-carbaldehyde |
| SMILES | CC(CC1OC(C)(C)OC1C=O)OCOCC[Si](C)(C)C |
| InChI | InChI=1S/C15H30O5Si/c1-12(18-11-17-7-8-21(4,5)6)9-13-14(10-16)20-15(2,3)19-13/h10,12-14H,7-9,11H2,1-6H3 |
| InChIKey | OLHMIIBDMRMZMJ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.49 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|