C20H32O3 — CID 10734491
methyl 4-[4-(1-hydroxy-6,6-dimethylheptyl)phenyl]butanoate (PubChem CID 10734491) has the molecular formula C20H32O3 and a molecular weight of 320.47 g/mol. Its IUPAC name is methyl 4-[4-(1-hydroxy-6,6-dimethylheptyl)phenyl]butanoate.
| Compound Name | methyl 4-[4-(1-hydroxy-6,6-dimethylheptyl)phenyl]butanoate |
|---|---|
| PubChem CID | 10734491 |
| Molecular Formula | C20H32O3 |
| Molecular Weight | 320.47 g/mol |
| Exact Mass | 320.24 |
| IUPAC Name | methyl 4-[4-(1-hydroxy-6,6-dimethylheptyl)phenyl]butanoate |
| SMILES | COC(=O)CCCc1ccc(C(O)CCCCC(C)(C)C)cc1 |
| InChI | InChI=1S/C20H32O3/c1-20(2,3)15-6-5-9-18(21)17-13-11-16(12-14-17)8-7-10-19(22)23-4/h11-14,18,21H,5-10,15H2,1-4H3 |
| InChIKey | RQGIMQIWWLHYON-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.47 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|