C12H10N4O5 — CID 107345726
1-[(3-carbamoylphenyl)methyl]-4-nitropyrazole-3-carboxylic acid (PubChem CID 107345726) has the molecular formula C12H10N4O5 and a molecular weight of 290.24 g/mol. Its IUPAC name is 1-[(3-carbamoylphenyl)methyl]-4-nitropyrazole-3-carboxylic acid.
| Compound Name | 1-[(3-carbamoylphenyl)methyl]-4-nitropyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 107345726 |
| Molecular Formula | C12H10N4O5 |
| Molecular Weight | 290.24 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | 1-[(3-carbamoylphenyl)methyl]-4-nitropyrazole-3-carboxylic acid |
| SMILES | NC(=O)c1cccc(Cn2cc([N+](=O)[O-])c(C(=O)O)n2)c1 |
| InChI | InChI=1S/C12H10N4O5/c13-11(17)8-3-1-2-7(4-8)5-15-6-9(16(20)21)10(14-15)12(18)19/h1-4,6H,5H2,(H2,13,17)(H,18,19) |
| InChIKey | VQJNXVGQNZSIDL-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 141.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.24 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|