C9H9N5O2 — CID 107351729
2-nitro-6-(1,2,4-triazol-1-ylmethyl)aniline (PubChem CID 107351729) has the molecular formula C9H9N5O2 and a molecular weight of 219.20 g/mol. Its IUPAC name is 2-nitro-6-(1,2,4-triazol-1-ylmethyl)aniline.
| Compound Name | 2-nitro-6-(1,2,4-triazol-1-ylmethyl)aniline |
|---|---|
| PubChem CID | 107351729 |
| Molecular Formula | C9H9N5O2 |
| Molecular Weight | 219.20 g/mol |
| Exact Mass | 219.08 |
| IUPAC Name | 2-nitro-6-(1,2,4-triazol-1-ylmethyl)aniline |
| SMILES | Nc1c(Cn2cncn2)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H9N5O2/c10-9-7(4-13-6-11-5-12-13)2-1-3-8(9)14(15)16/h1-3,5-6H,4,10H2 |
| InChIKey | FYYQLQZZCQYOHA-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 99.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.20 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|